C9H14N2 — CID 123707511
(Z,5E)-5-ethylidenehept-3-ene-2,6-diimine (PubChem CID 123707511) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z,5E)-5-ethylidenehept-3-ene-2,6-diimine.
| Compound Name | (Z,5E)-5-ethylidenehept-3-ene-2,6-diimine |
|---|---|
| PubChem CID | 123707511 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z,5E)-5-ethylidenehept-3-ene-2,6-diimine |
| SMILES | [H]/N=C(C)/C=C\C(=C/C)\C(C)=N\[H] |
| InChI | InChI=1S/C9H14N2/c1-4-9(8(3)11)6-5-7(2)10/h4-6,10-11H,1-3H3/b6-5-,9-4+,10-7+,11-8+ |
| InChIKey | VMFRXCQSGHGKEA-UBGKCJIESA-N |
| XLogP | 2.57 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|