C10H15N — CID 90864895
3-ethenyl-5-methylhepta-3,5-dien-2-imine (PubChem CID 90864895) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-ethenyl-5-methylhepta-3,5-dien-2-imine.
| Compound Name | 3-ethenyl-5-methylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 90864895 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-ethenyl-5-methylhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C=C)=CC(C)=CC |
| InChI | InChI=1S/C10H15N/c1-5-8(3)7-10(6-2)9(4)11/h5-7,11H,2H2,1,3-4H3/b8-5?,10-7?,11-9+ |
| InChIKey | GBSGOZIAZVQQKM-CXIQQOHMSA-N |
| XLogP | 3.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|