C11H17NO — CID 143013710
(2E,4Z)-2-ethenyl-N,N,4-trimethylhexa-2,4-dienamide (PubChem CID 143013710) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N,N,4-trimethylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-ethenyl-N,N,4-trimethylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 143013710 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N,N,4-trimethylhexa-2,4-dienamide |
| SMILES | C=C/C(=C\C(C)=C/C)C(=O)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-6-9(3)8-10(7-2)11(13)12(4)5/h6-8H,2H2,1,3-5H3/b9-6-,10-8+ |
| InChIKey | YUQVXLHFTRRRSD-NULKZJHKSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|