C6H14N2O — CID 162327856
azane;N,N,2-trimethylprop-2-enamide (PubChem CID 162327856) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is azane;N,N,2-trimethylprop-2-enamide.
| Compound Name | azane;N,N,2-trimethylprop-2-enamide |
|---|---|
| PubChem CID | 162327856 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | azane;N,N,2-trimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)C.N |
| InChI | InChI=1S/C6H11NO.H3N/c1-5(2)6(8)7(3)4;/h1H2,2-4H3;1H3 |
| InChIKey | GWRWYNBNFMJYBO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|