C14H25NO3 — CID 158640879
methyl 2-methylprop-2-enoate;prop-1-ene;N,N,2-trimethylprop-2-enamide (PubChem CID 158640879) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;prop-1-ene;N,N,2-trimethylprop-2-enamide.
| Compound Name | methyl 2-methylprop-2-enoate;prop-1-ene;N,N,2-trimethylprop-2-enamide |
|---|---|
| PubChem CID | 158640879 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | methyl 2-methylprop-2-enoate;prop-1-ene;N,N,2-trimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)C.C=C(C)C(=O)OC.C=CC |
| InChI | InChI=1S/C6H11NO.C5H8O2.C3H6/c1-5(2)6(8)7(3)4;1-4(2)5(6)7-3;1-3-2/h1H2,2-4H3;1H2,2-3H3;3H,1H2,2H3 |
| InChIKey | IAJDEJUMRZOKDU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|