About methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+)
methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) (PubChem CID 157143230) has the molecular formula C17H28O10Si
and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+).
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) |
| PubChem CID | 157143230 |
| Molecular Formula | C17H28O10Si |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)[O-].C=CC(=O)[O-].C=CC(=O)[O-].C=CC(=O)[O-].[SiH8+4] |
| InChI | InChI=1S/C5H8O2.4C3H4O2.H8Si/c1-4(2)5(6)7-3;4*1-2-3(4)5;/h1H2,2-3H3;4*2H,1H2,(H,4,5);1H8/q;;;;;+4/p-4 |
| InChIKey | APOQEOWXNIVHSO-UHFFFAOYSA-J |
| XLogP | -6.10 |
| TPSA | 186.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+)?
The IUPAC name of methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) (CID 157143230) is methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+).
What is the SMILES notation for methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+)?
The canonical SMILES for methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) is C=C(C)C(=O)OC.C=CC(=O)[O-].C=CC(=O)[O-].C=CC(=O)[O-].C=CC(=O)[O-].[SiH8+4].
What is the InChIKey of methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+)?
The InChIKey is APOQEOWXNIVHSO-UHFFFAOYSA-J. The full InChI is InChI=1S/C5H8O2.4C3H4O2.H8Si/c1-4(2)5(6)7-3;4*1-2-3(4)5;/h1H2,2-3H3;4*2H,1H2,(H,4,5);1H8/q;;;;;+4/p-4.
What are the key properties of methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+)?
methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) has a molecular weight of 420.49 g/mol, XLogP of -6.10, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;tetrakis(prop-2-enoate);silicon(4+) is sourced from PubChem (CID 157143230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).