C19H15F5MnN2O2 — CID 177064575
(2E,4Z)-2-ethenyl-1-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-4-methylhexa-2,4-dien-1-one;manganese (PubChem CID 177064575) has the molecular formula C19H15F5MnN2O2 and a molecular weight of 453.27 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-1-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-4-methylhexa-2,4-dien-1-one;manganese.
| Compound Name | (2E,4Z)-2-ethenyl-1-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-4-methylhexa-2,4-dien-1-one;manganese |
|---|---|
| PubChem CID | 177064575 |
| Molecular Formula | C19H15F5MnN2O2 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | (2E,4Z)-2-ethenyl-1-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-4-methylhexa-2,4-dien-1-one;manganese |
| SMILES | C=C/C(=C\C(C)=C/C)C(=O)c1c(C)nn(-c2c(F)c(F)c(F)c(F)c2F)c1O.[Mn] |
| InChI | InChI=1S/C19H15F5N2O2.Mn/c1-5-8(3)7-10(6-2)18(27)11-9(4)25-26(19(11)28)17-15(23)13(21)12(20)14(22)16(17)24;/h5-7,28H,2H2,1,3-4H3;/b8-5-,10-7+; |
| InChIKey | VHGCXJWOJTWAGJ-ABCYDXHISA-N |
| XLogP | 4.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|