C16H6F8N4O2Zn — CID 177064863
(2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]pyrazol-4-yl]methanone;zinc (PubChem CID 177064863) has the molecular formula C16H6F8N4O2Zn and a molecular weight of 503.62 g/mol. Its IUPAC name is (2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]pyrazol-4-yl]methanone;zinc.
| Compound Name | (2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]pyrazol-4-yl]methanone;zinc |
|---|---|
| PubChem CID | 177064863 |
| Molecular Formula | C16H6F8N4O2Zn |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 501.97 |
| IUPAC Name | (2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]pyrazol-4-yl]methanone;zinc |
| SMILES | Cc1nn(-c2c(F)c(F)nc(C(F)(F)F)c2F)c(O)c1C(=O)c1cc(F)nc(F)c1.[Zn] |
| InChI | InChI=1S/C16H6F8N4O2.Zn/c1-4-8(12(29)5-2-6(17)25-7(18)3-5)15(30)28(27-4)11-9(19)13(16(22,23)24)26-14(21)10(11)20;/h2-3,30H,1H3; |
| InChIKey | RHTKTYABHVTDTG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|