C16H7CuF6N3O2 — CID 177209900
copper;(2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazol-4-yl]methanone (PubChem CID 177209900) has the molecular formula C16H7CuF6N3O2 and a molecular weight of 450.79 g/mol. Its IUPAC name is copper;(2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazol-4-yl]methanone.
| Compound Name | copper;(2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 177209900 |
| Molecular Formula | C16H7CuF6N3O2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | copper;(2,6-difluoro-4-pyridinyl)-[5-hydroxy-3-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazol-4-yl]methanone |
| SMILES | Cc1nn(-c2c(F)c(F)cc(F)c2F)c(O)c1C(=O)c1cc(F)nc(F)c1.[Cu] |
| InChI | InChI=1S/C16H7F6N3O2.Cu/c1-5-11(15(26)6-2-9(19)23-10(20)3-6)16(27)25(24-5)14-12(21)7(17)4-8(18)13(14)22;/h2-4,27H,1H3; |
| InChIKey | JTCFCBCBPCADKK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|