C17H7CuF5N4O2 — CID 177209971
copper;2,3,5,6-tetrafluoro-4-[4-(2-fluoropyridine-4-carbonyl)-5-hydroxy-3-methylpyrazol-1-yl]benzonitrile (PubChem CID 177209971) has the molecular formula C17H7CuF5N4O2 and a molecular weight of 457.81 g/mol. Its IUPAC name is copper;2,3,5,6-tetrafluoro-4-[4-(2-fluoropyridine-4-carbonyl)-5-hydroxy-3-methylpyrazol-1-yl]benzonitrile.
| Compound Name | copper;2,3,5,6-tetrafluoro-4-[4-(2-fluoropyridine-4-carbonyl)-5-hydroxy-3-methylpyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 177209971 |
| Molecular Formula | C17H7CuF5N4O2 |
| Molecular Weight | 457.81 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | copper;2,3,5,6-tetrafluoro-4-[4-(2-fluoropyridine-4-carbonyl)-5-hydroxy-3-methylpyrazol-1-yl]benzonitrile |
| SMILES | Cc1nn(-c2c(F)c(F)c(C#N)c(F)c2F)c(O)c1C(=O)c1ccnc(F)c1.[Cu] |
| InChI | InChI=1S/C17H7F5N4O2.Cu/c1-6-10(16(27)7-2-3-24-9(18)4-7)17(28)26(25-6)15-13(21)11(19)8(5-23)12(20)14(15)22;/h2-4,28H,1H3; |
| InChIKey | FMSLPKOUYCWDCP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|