C17H4F10N2O2Zn — CID 177064829
[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-(2,3,4,5,6-pentafluorophenyl)methanone;zinc (PubChem CID 177064829) has the molecular formula C17H4F10N2O2Zn and a molecular weight of 523.60 g/mol. Its IUPAC name is [5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-(2,3,4,5,6-pentafluorophenyl)methanone;zinc.
| Compound Name | [5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-(2,3,4,5,6-pentafluorophenyl)methanone;zinc |
|---|---|
| PubChem CID | 177064829 |
| Molecular Formula | C17H4F10N2O2Zn |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | [5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]-(2,3,4,5,6-pentafluorophenyl)methanone;zinc |
| SMILES | Cc1nn(-c2c(F)c(F)c(F)c(F)c2F)c(O)c1C(=O)c1c(F)c(F)c(F)c(F)c1F.[Zn] |
| InChI | InChI=1S/C17H4F10N2O2.Zn/c1-2-3(16(30)4-5(18)7(20)9(22)8(21)6(4)19)17(31)29(28-2)15-13(26)11(24)10(23)12(25)14(15)27;/h31H,1H3; |
| InChIKey | OBVFZXKAQUULRY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|