About 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese
1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese (PubChem CID 177064731) has the molecular formula C12H11FMnN2O2
and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese.
Molecular Properties
| Compound Name | 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese |
| PubChem CID | 177064731 |
| Molecular Formula | C12H11FMnN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese |
| SMILES | CC(=O)c1c(C)nn(-c2ccccc2F)c1O.[Mn] |
| InChI | InChI=1S/C12H11FN2O2.Mn/c1-7-11(8(2)16)12(17)15(14-7)10-6-4-3-5-9(10)13;/h3-6,17H,1-2H3; |
| InChIKey | DEGRNWPLTKUVGL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese?
The IUPAC name of 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese (CID 177064731) is 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese.
What is the SMILES notation for 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese?
The canonical SMILES for 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese is CC(=O)c1c(C)nn(-c2ccccc2F)c1O.[Mn].
What is the InChIKey of 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese?
The InChIKey is DEGRNWPLTKUVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O2.Mn/c1-7-11(8(2)16)12(17)15(14-7)10-6-4-3-5-9(10)13;/h3-6,17H,1-2H3;.
What are the key properties of 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese?
1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese has a molecular weight of 289.17 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2-fluorophenyl)-5-hydroxy-3-methylpyrazol-4-yl]ethanone;manganese is sourced from PubChem (CID 177064731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).