C7H11N — CID 130197601
5-methylhexa-1,4-dien-3-imine (PubChem CID 130197601) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 5-methylhexa-1,4-dien-3-imine.
| Compound Name | 5-methylhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 130197601 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 5-methylhexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C=C(C)C |
| InChI | InChI=1S/C7H11N/c1-4-7(8)5-6(2)3/h4-5,8H,1H2,2-3H3/b8-7+ |
| InChIKey | KVHHFMDMULZLNH-BQYQJAHWSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|