C11H19N — CID 126639572
(3Z)-3-ethyl-4,6-dimethylhepta-3,5-dien-2-imine (PubChem CID 126639572) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3Z)-3-ethyl-4,6-dimethylhepta-3,5-dien-2-imine.
| Compound Name | (3Z)-3-ethyl-4,6-dimethylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 126639572 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3Z)-3-ethyl-4,6-dimethylhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(CC)=C(/C)C=C(C)C |
| InChI | InChI=1S/C11H19N/c1-6-11(10(5)12)9(4)7-8(2)3/h7,12H,6H2,1-5H3/b11-9-,12-10+ |
| InChIKey | BDOJLRRXYGBPQK-DSOJMZEYSA-N |
| XLogP | 3.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|