C14H21N3 — CID 176523288
(Z)-N'-ethenyl-N-[(3Z)-4-ethyl-5-iminohexa-1,3-dien-3-yl]but-2-enimidamide (PubChem CID 176523288) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (Z)-N'-ethenyl-N-[(3Z)-4-ethyl-5-iminohexa-1,3-dien-3-yl]but-2-enimidamide.
| Compound Name | (Z)-N'-ethenyl-N-[(3Z)-4-ethyl-5-iminohexa-1,3-dien-3-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 176523288 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (Z)-N'-ethenyl-N-[(3Z)-4-ethyl-5-iminohexa-1,3-dien-3-yl]but-2-enimidamide |
| SMILES | [H]/N=C(C)/C(CC)=C(/C=C)NC(/C=C\C)=N/C=C |
| InChI | InChI=1S/C14H21N3/c1-6-10-14(16-9-4)17-13(8-3)12(7-2)11(5)15/h6,8-10,15H,3-4,7H2,1-2,5H3,(H,16,17)/b10-6-,13-12-,15-11+ |
| InChIKey | RHTHKOCSCCIDFR-PSEFUVBQSA-N |
| XLogP | 3.58 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|