C10H15N — CID 143053895
(5Z)-N-ethenyl-2-methylhepta-2,5-dien-4-imine (PubChem CID 143053895) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (5Z)-N-ethenyl-2-methylhepta-2,5-dien-4-imine.
| Compound Name | (5Z)-N-ethenyl-2-methylhepta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 143053895 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (5Z)-N-ethenyl-2-methylhepta-2,5-dien-4-imine |
| SMILES | C=C/N=C(C=C(C)C)/C=C\C |
| InChI | InChI=1S/C10H15N/c1-5-7-10(11-6-2)8-9(3)4/h5-8H,2H2,1,3-4H3/b7-5-,11-10- |
| InChIKey | SIHJLZVSVHUSDK-YLRXWAGNSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|