C7H11N3 — CID 145103734
(Z,1E)-N-ethenyl-1-hydrazinylidenepent-3-en-2-imine (PubChem CID 145103734) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (Z,1E)-N-ethenyl-1-hydrazinylidenepent-3-en-2-imine.
| Compound Name | (Z,1E)-N-ethenyl-1-hydrazinylidenepent-3-en-2-imine |
|---|---|
| PubChem CID | 145103734 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (Z,1E)-N-ethenyl-1-hydrazinylidenepent-3-en-2-imine |
| SMILES | C=C/N=C(/C=C\C)\C=N\N |
| InChI | InChI=1S/C7H11N3/c1-3-5-7(6-10-8)9-4-2/h3-6H,2,8H2,1H3/b5-3-,9-7-,10-6+ |
| InChIKey | XJYSIVPFMFQDOK-QVFMRCLASA-N |
| XLogP | 1.09 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|