C12H11F2N — CID 142896113
(Z)-1-(2,4-difluorophenyl)-N-ethenylbut-2-en-1-imine (PubChem CID 142896113) has the molecular formula C12H11F2N and a molecular weight of 207.22 g/mol. Its IUPAC name is (Z)-1-(2,4-difluorophenyl)-N-ethenylbut-2-en-1-imine.
| Compound Name | (Z)-1-(2,4-difluorophenyl)-N-ethenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142896113 |
| Molecular Formula | C12H11F2N |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (Z)-1-(2,4-difluorophenyl)-N-ethenylbut-2-en-1-imine |
| SMILES | C=C/N=C(\C=C/C)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H11F2N/c1-3-5-12(15-4-2)10-7-6-9(13)8-11(10)14/h3-8H,2H2,1H3/b5-3-,15-12+ |
| InChIKey | XXBKQVXWLWJXKK-HJGNFNJESA-N |
| XLogP | 3.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|