C11H9F2N — CID 59027692
(2Z)-1-(2,4-difluorophenyl)penta-2,4-dien-1-imine (PubChem CID 59027692) has the molecular formula C11H9F2N and a molecular weight of 193.20 g/mol. Its IUPAC name is (2Z)-1-(2,4-difluorophenyl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-(2,4-difluorophenyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 59027692 |
| Molecular Formula | C11H9F2N |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (2Z)-1-(2,4-difluorophenyl)penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9F2N/c1-2-3-4-11(14)9-6-5-8(12)7-10(9)13/h2-7,14H,1H2/b4-3-,14-11+ |
| InChIKey | JFAZVOZJGTXALO-DSBCBKPPSA-N |
| XLogP | 3.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|