C15H16F2 — CID 143767770
2,4-difluoro-1-[(4E,6Z)-nona-4,6,8-trien-4-yl]benzene (PubChem CID 143767770) has the molecular formula C15H16F2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2,4-difluoro-1-[(4E,6Z)-nona-4,6,8-trien-4-yl]benzene.
| Compound Name | 2,4-difluoro-1-[(4E,6Z)-nona-4,6,8-trien-4-yl]benzene |
|---|---|
| PubChem CID | 143767770 |
| Molecular Formula | C15H16F2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2,4-difluoro-1-[(4E,6Z)-nona-4,6,8-trien-4-yl]benzene |
| SMILES | C=C/C=C\C=C(/CCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2/c1-3-5-6-8-12(7-4-2)14-10-9-13(16)11-15(14)17/h3,5-6,8-11H,1,4,7H2,2H3/b6-5-,12-8+ |
| InChIKey | CENCKMFYKOPUPB-ZBKAMDABSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|