C26H31F2N3 — CID 170175784
N-[(1Z,3E)-4-[4-[4-[(2,4-difluorophenyl)methyl]piperidin-1-yl]-6-methyl-3-pyridinyl]hepta-1,3-dienyl]methanimine (PubChem CID 170175784) has the molecular formula C26H31F2N3 and a molecular weight of 423.55 g/mol. Its IUPAC name is N-[(1Z,3E)-4-[4-[4-[(2,4-difluorophenyl)methyl]piperidin-1-yl]-6-methyl-3-pyridinyl]hepta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-4-[4-[4-[(2,4-difluorophenyl)methyl]piperidin-1-yl]-6-methyl-3-pyridinyl]hepta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 170175784 |
| Molecular Formula | C26H31F2N3 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[(1Z,3E)-4-[4-[4-[(2,4-difluorophenyl)methyl]piperidin-1-yl]-6-methyl-3-pyridinyl]hepta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C=C(/CCC)c1cnc(C)cc1N1CCC(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C26H31F2N3/c1-4-6-21(7-5-12-29-3)24-18-30-19(2)15-26(24)31-13-10-20(11-14-31)16-22-8-9-23(27)17-25(22)28/h5,7-9,12,15,17-18,20H,3-4,6,10-11,13-14,16H2,1-2H3/b12-5-,21-7+ |
| InChIKey | ISJRASMFIGGEGL-WORBVMTCSA-N |
| XLogP | 6.53 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|