C15H23ClN2 — CID 81235658
5-(chloromethyl)-2-methyl-4-(4-propylpiperidin-1-yl)pyridine (PubChem CID 81235658) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 5-(chloromethyl)-2-methyl-4-(4-propylpiperidin-1-yl)pyridine.
| Compound Name | 5-(chloromethyl)-2-methyl-4-(4-propylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 81235658 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-(chloromethyl)-2-methyl-4-(4-propylpiperidin-1-yl)pyridine |
| SMILES | CCCC1CCN(c2cc(C)ncc2CCl)CC1 |
| InChI | InChI=1S/C15H23ClN2/c1-3-4-13-5-7-18(8-6-13)15-9-12(2)17-11-14(15)10-16/h9,11,13H,3-8,10H2,1-2H3 |
| InChIKey | WECAEHMYHDTJDC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|