C17H26ClN3 — CID 81237461
5-(chloromethyl)-2-methyl-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]pyridine (PubChem CID 81237461) has the molecular formula C17H26ClN3 and a molecular weight of 307.87 g/mol. Its IUPAC name is 5-(chloromethyl)-2-methyl-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]pyridine.
| Compound Name | 5-(chloromethyl)-2-methyl-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 81237461 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 5-(chloromethyl)-2-methyl-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]pyridine |
| SMILES | Cc1cc(N2CCC(CN3CCCC3)CC2)c(CCl)cn1 |
| InChI | InChI=1S/C17H26ClN3/c1-14-10-17(16(11-18)12-19-14)21-8-4-15(5-9-21)13-20-6-2-3-7-20/h10,12,15H,2-9,11,13H2,1H3 |
| InChIKey | GLPUNHOYDTXWPV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|