C9H8F2 — CID 10877333
2,4-difluoro-1-prop-1-en-2-ylbenzene (PubChem CID 10877333) has the molecular formula C9H8F2 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2,4-difluoro-1-prop-1-en-2-ylbenzene.
| Compound Name | 2,4-difluoro-1-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 10877333 |
| Molecular Formula | C9H8F2 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,4-difluoro-1-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H8F2/c1-6(2)8-4-3-7(10)5-9(8)11/h3-5H,1H2,2H3 |
| InChIKey | XSROFNLUQOGWON-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |