C12H13F — CID 139356848
4-fluoro-1,2-bis(prop-1-en-2-yl)benzene (PubChem CID 139356848) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is 4-fluoro-1,2-bis(prop-1-en-2-yl)benzene.
| Compound Name | 4-fluoro-1,2-bis(prop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 139356848 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 4-fluoro-1,2-bis(prop-1-en-2-yl)benzene |
| SMILES | C=C(C)c1ccc(F)cc1C(=C)C |
| InChI | InChI=1S/C12H13F/c1-8(2)11-6-5-10(13)7-12(11)9(3)4/h5-7H,1,3H2,2,4H3 |
| InChIKey | JVBIZUJWDYQCAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |