C13H18F2N2 — CID 141399914
2,4-difluoro-N,N-dipropylbenzenecarboximidamide (PubChem CID 141399914) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2,4-difluoro-N,N-dipropylbenzenecarboximidamide.
| Compound Name | 2,4-difluoro-N,N-dipropylbenzenecarboximidamide |
|---|---|
| PubChem CID | 141399914 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2,4-difluoro-N,N-dipropylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(F)cc1F)N(CCC)CCC |
| InChI | InChI=1S/C13H18F2N2/c1-3-7-17(8-4-2)13(16)11-6-5-10(14)9-12(11)15/h5-6,9,16H,3-4,7-8H2,1-2H3/b16-13- |
| InChIKey | KZSZAATZXBOBHY-SSZFMOIBSA-N |
| XLogP | 3.41 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|