C11H14BrFN2 — CID 107924400
2-bromo-N,N-diethyl-5-fluorobenzenecarboximidamide (PubChem CID 107924400) has the molecular formula C11H14BrFN2 and a molecular weight of 273.15 g/mol. Its IUPAC name is 2-bromo-N,N-diethyl-5-fluorobenzenecarboximidamide.
| Compound Name | 2-bromo-N,N-diethyl-5-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107924400 |
| Molecular Formula | C11H14BrFN2 |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-bromo-N,N-diethyl-5-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cc(F)ccc1Br)N(CC)CC |
| InChI | InChI=1S/C11H14BrFN2/c1-3-15(4-2)11(14)9-7-8(13)5-6-10(9)12/h5-7,14H,3-4H2,1-2H3/b14-11- |
| InChIKey | KRLVCQOVFILWTK-KAMYIIQDSA-N |
| XLogP | 3.26 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|