C12H17FN2 — CID 63179121
N,N-diethyl-5-fluoro-2-methylbenzenecarboximidamide (PubChem CID 63179121) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N,N-diethyl-5-fluoro-2-methylbenzenecarboximidamide.
| Compound Name | N,N-diethyl-5-fluoro-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 63179121 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N,N-diethyl-5-fluoro-2-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cc(F)ccc1C)N(CC)CC |
| InChI | InChI=1S/C12H17FN2/c1-4-15(5-2)12(14)11-8-10(13)7-6-9(11)3/h6-8,14H,4-5H2,1-3H3/b14-12- |
| InChIKey | PVOASYZHFRFOFI-OWBHPGMISA-N |
| XLogP | 2.80 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|