C27H30ClF2N5O2 — CID 142083292
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-4-(N-ethyl-N-propylcarbamimidoyl)-2-fluorobenzamide;ethane (PubChem CID 142083292) has the molecular formula C27H30ClF2N5O2 and a molecular weight of 530.02 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-4-(N-ethyl-N-propylcarbamimidoyl)-2-fluorobenzamide;ethane.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-4-(N-ethyl-N-propylcarbamimidoyl)-2-fluorobenzamide;ethane |
|---|---|
| PubChem CID | 142083292 |
| Molecular Formula | C27H30ClF2N5O2 |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-fluorophenyl]-4-(N-ethyl-N-propylcarbamimidoyl)-2-fluorobenzamide;ethane |
| SMILES | CC.[H]/N=C(/c1ccc(C(=O)Nc2ccc(F)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(CC)CCC |
| InChI | InChI=1S/C25H24ClF2N5O2.C2H6/c1-3-11-33(4-2)23(29)15-5-8-18(20(28)12-15)24(34)31-21-9-7-17(27)13-19(21)25(35)32-22-10-6-16(26)14-30-22;1-2/h5-10,12-14,29H,3-4,11H2,1-2H3,(H,31,34)(H,30,32,35);1-2H3/b29-23-; |
| InChIKey | WERWTHJZNANOMB-MBANDDHJSA-N |
| XLogP | 6.60 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|