C23H21BrFN5O2 — CID 18728047
N-(5-bromo-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-methylbenzamide (PubChem CID 18728047) has the molecular formula C23H21BrFN5O2 and a molecular weight of 498.36 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-methylbenzamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-methylbenzamide |
|---|---|
| PubChem CID | 18728047 |
| Molecular Formula | C23H21BrFN5O2 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-methylbenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(C)cc2C(=O)Nc2ccc(Br)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C23H21BrFN5O2/c1-13-4-8-19(17(10-13)23(32)29-20-9-6-15(24)12-27-20)28-22(31)16-7-5-14(11-18(16)25)21(26)30(2)3/h4-12,26H,1-3H3,(H,28,31)(H,27,29,32)/b26-21- |
| InChIKey | LRVXUWODCZGJIW-QLYXXIJNSA-N |
| XLogP | 4.68 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|