C24H19ClFN5O2 — CID 10115724
N-[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide (PubChem CID 10115724) has the molecular formula C24H19ClFN5O2 and a molecular weight of 463.90 g/mol. Its IUPAC name is N-[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide.
| Compound Name | N-[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 10115724 |
| Molecular Formula | C24H19ClFN5O2 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H19ClFN5O2/c1-4-14-5-10-21(28-13-14)30-24(33)18-12-16(25)7-9-20(18)29-23(32)17-8-6-15(11-19(17)26)22(27)31(2)3/h1,5-13,27H,2-3H3,(H,29,32)(H,28,30,33)/b27-22- |
| InChIKey | NBOYNZMWKWEPKM-QYQHSDTDSA-N |
| XLogP | 4.25 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|