C25H21FN4O2 — CID 142175200
4-(N,N-dimethylcarbamimidoyl)-N-[2-[(4-ethynylphenyl)carbamoyl]phenyl]-2-fluorobenzamide (PubChem CID 142175200) has the molecular formula C25H21FN4O2 and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-(N,N-dimethylcarbamimidoyl)-N-[2-[(4-ethynylphenyl)carbamoyl]phenyl]-2-fluorobenzamide.
| Compound Name | 4-(N,N-dimethylcarbamimidoyl)-N-[2-[(4-ethynylphenyl)carbamoyl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 142175200 |
| Molecular Formula | C25H21FN4O2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-(N,N-dimethylcarbamimidoyl)-N-[2-[(4-ethynylphenyl)carbamoyl]phenyl]-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc(C#C)cc2)c(F)c1)N(C)C |
| InChI | InChI=1S/C25H21FN4O2/c1-4-16-9-12-18(13-10-16)28-25(32)20-7-5-6-8-22(20)29-24(31)19-14-11-17(15-21(19)26)23(27)30(2)3/h1,5-15,27H,2-3H3,(H,28,32)(H,29,31)/b27-23- |
| InChIKey | FGYADJAQZTYAEO-VYIQYICTSA-N |
| XLogP | 4.20 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|