C26H24N4O3 — CID 59020955
2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide (PubChem CID 59020955) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide.
| Compound Name | 2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 59020955 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(4-ethynylphenyl)-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cccc2C(=O)Nc2ccc(C#C)cc2)cc1)N(C)C |
| InChI | InChI=1S/C26H24N4O3/c1-5-17-9-15-20(16-10-17)28-26(32)21-7-6-8-22(33-4)23(21)29-25(31)19-13-11-18(12-14-19)24(27)30(2)3/h1,6-16,27H,2-4H3,(H,28,32)(H,29,31)/b27-24- |
| InChIKey | MHWCMSUEGNBFAW-PNHLSOANSA-N |
| XLogP | 4.07 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|