C29H34ClN5O3 — CID 142175077
5-chloro-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(5-ethynyl-2-pyridinyl)-3-methoxybenzamide;ethane (PubChem CID 142175077) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is 5-chloro-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(5-ethynyl-2-pyridinyl)-3-methoxybenzamide;ethane.
| Compound Name | 5-chloro-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(5-ethynyl-2-pyridinyl)-3-methoxybenzamide;ethane |
|---|---|
| PubChem CID | 142175077 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 5-chloro-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-N-(5-ethynyl-2-pyridinyl)-3-methoxybenzamide;ethane |
| SMILES | CC.CC.[H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)cc1)N(C)C |
| InChI | InChI=1S/C25H22ClN5O3.2C2H6/c1-5-15-6-11-21(28-14-15)29-25(33)19-12-18(26)13-20(34-4)22(19)30-24(32)17-9-7-16(8-10-17)23(27)31(2)3;2*1-2/h1,6-14,27H,2-4H3,(H,30,32)(H,28,29,33);2*1-2H3/b27-23-;; |
| InChIKey | QSMRAEKUFKXMDE-CJCCHCNLSA-N |
| XLogP | 6.17 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|