C31H30ClN5O5 — CID 59020758
ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]benzenecarboximidoyl]piperidine-4-carboxylate (PubChem CID 59020758) has the molecular formula C31H30ClN5O5 and a molecular weight of 588.06 g/mol. Its IUPAC name is ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]benzenecarboximidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]benzenecarboximidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59020758 |
| Molecular Formula | C31H30ClN5O5 |
| Molecular Weight | 588.06 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | ethyl 1-[4-[[4-chloro-2-[(5-ethynyl-2-pyridinyl)carbamoyl]-6-methoxyphenyl]carbamoyl]benzenecarboximidoyl]piperidine-4-carboxylate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cn2)cc1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C31H30ClN5O5/c1-4-19-6-11-26(34-18-19)35-30(39)24-16-23(32)17-25(41-3)27(24)36-29(38)21-9-7-20(8-10-21)28(33)37-14-12-22(13-15-37)31(40)42-5-2/h1,6-11,16-18,22,33H,5,12-15H2,2-3H3,(H,36,38)(H,34,35,39)/b33-28- |
| InChIKey | IMMDTZFVXLFLEO-MDVFONAFSA-N |
| XLogP | 4.83 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|