C32H30ClFN4O5 — CID 87850706
ethyl 1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidine-4-carboxylate (PubChem CID 87850706) has the molecular formula C32H30ClFN4O5 and a molecular weight of 605.07 g/mol. Its IUPAC name is ethyl 1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87850706 |
| Molecular Formula | C32H30ClFN4O5 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | ethyl 1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidine-4-carboxylate |
| SMILES | C#Cc1ccc(NC(=O)c2cc(Cl)cc(OC)c2NC(=O)c2ccc(/N=C/N3CCC(C(=O)OCC)CC3)cc2F)cc1 |
| InChI | InChI=1S/C32H30ClFN4O5/c1-4-20-6-8-23(9-7-20)36-31(40)26-16-22(33)17-28(42-3)29(26)37-30(39)25-11-10-24(18-27(25)34)35-19-38-14-12-21(13-15-38)32(41)43-5-2/h1,6-11,16-19,21H,5,12-15H2,2-3H3,(H,36,40)(H,37,39)/b35-19+ |
| InChIKey | WERILRZOHUCVIE-XZYGTATASA-N |
| XLogP | 5.91 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|