C29H26N4O3 — CID 87850505
2-[[4-[[ethyl(methyl)hydrazinylidene]methyl]benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide (PubChem CID 87850505) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[[4-[[ethyl(methyl)hydrazinylidene]methyl]benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide.
| Compound Name | 2-[[4-[[ethyl(methyl)hydrazinylidene]methyl]benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 87850505 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[[4-[[ethyl(methyl)hydrazinylidene]methyl]benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide |
| SMILES | C#Cc1ccc(NC(=O)c2cc(C#C)cc(OC)c2NC(=O)c2ccc(C=NN(C)CC)cc2)cc1 |
| InChI | InChI=1S/C29H26N4O3/c1-6-20-11-15-24(16-12-20)31-29(35)25-17-21(7-2)18-26(36-5)27(25)32-28(34)23-13-9-22(10-14-23)19-30-33(4)8-3/h1-2,9-19H,8H2,3-5H3,(H,31,35)(H,32,34) |
| InChIKey | BPCNIGIIPJTZJG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|