C29H26N4O3 — CID 59020941
2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide (PubChem CID 59020941) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide.
| Compound Name | 2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 59020941 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[[4-(N-ethyl-N-methylcarbamimidoyl)benzoyl]amino]-5-ethynyl-N-(4-ethynylphenyl)-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(C#C)cc2C(=O)Nc2ccc(C#C)cc2)cc1)N(C)CC |
| InChI | InChI=1S/C29H26N4O3/c1-6-19-9-15-23(16-10-19)31-29(35)24-17-20(7-2)18-25(36-5)26(24)32-28(34)22-13-11-21(12-14-22)27(30)33(4)8-3/h1-2,9-18,30H,8H2,3-5H3,(H,31,35)(H,32,34)/b30-27- |
| InChIKey | KTOUTKBMJLNYHE-IKPAITLHSA-N |
| XLogP | 4.44 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|