C26H25FI2N4O3 — CID 89387222
2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-(iodomethyl)-N-[4-(iodomethyl)phenyl]-3-methoxybenzamide (PubChem CID 89387222) has the molecular formula C26H25FI2N4O3 and a molecular weight of 714.32 g/mol. Its IUPAC name is 2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-(iodomethyl)-N-[4-(iodomethyl)phenyl]-3-methoxybenzamide.
| Compound Name | 2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-(iodomethyl)-N-[4-(iodomethyl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 89387222 |
| Molecular Formula | C26H25FI2N4O3 |
| Molecular Weight | 714.32 g/mol |
| Exact Mass | 714.00 |
| IUPAC Name | 2-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]-5-(iodomethyl)-N-[4-(iodomethyl)phenyl]-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(CI)cc2C(=O)Nc2ccc(CI)cc2)c(F)c1)N(C)C |
| InChI | InChI=1S/C26H25FI2N4O3/c1-33(2)24(30)17-6-9-19(21(27)12-17)25(34)32-23-20(10-16(14-29)11-22(23)36-3)26(35)31-18-7-4-15(13-28)5-8-18/h4-12,30H,13-14H2,1-3H3,(H,31,35)(H,32,34)/b30-24- |
| InChIKey | ZLNYFAKGVAMVSN-KRUMMXJUSA-N |
| XLogP | 6.10 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|