C24H20F4N4O2 — CID 142175164
4-(N,N-dimethylcarbamimidoyl)-2-fluoro-N-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 142175164) has the molecular formula C24H20F4N4O2 and a molecular weight of 472.44 g/mol. Its IUPAC name is 4-(N,N-dimethylcarbamimidoyl)-2-fluoro-N-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 4-(N,N-dimethylcarbamimidoyl)-2-fluoro-N-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 142175164 |
| Molecular Formula | C24H20F4N4O2 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-(N,N-dimethylcarbamimidoyl)-2-fluoro-N-[2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc(C(F)(F)F)cc2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H20F4N4O2/c1-32(2)21(29)14-7-12-17(19(25)13-14)22(33)31-20-6-4-3-5-18(20)23(34)30-16-10-8-15(9-11-16)24(26,27)28/h3-13,29H,1-2H3,(H,30,34)(H,31,33)/b29-21- |
| InChIKey | XMEYVKYCVDSTLE-ANYBSYGZSA-N |
| XLogP | 5.24 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|