C24H19F4N5O — CID 20595337
N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1-(3-fluoronaphthalen-2-yl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 20595337) has the molecular formula C24H19F4N5O and a molecular weight of 469.44 g/mol. Its IUPAC name is N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1-(3-fluoronaphthalen-2-yl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1-(3-fluoronaphthalen-2-yl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 20595337 |
| Molecular Formula | C24H19F4N5O |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1-(3-fluoronaphthalen-2-yl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2cc(C(F)(F)F)nn2-c2cc3ccccc3cc2F)cc1)N(C)C |
| InChI | InChI=1S/C24H19F4N5O/c1-32(2)22(29)14-7-9-17(10-8-14)30-23(34)20-13-21(24(26,27)28)31-33(20)19-12-16-6-4-3-5-15(16)11-18(19)25/h3-13,29H,1-2H3,(H,30,34)/b29-22- |
| InChIKey | QMKZMABRUFDMJC-IADYIPOJSA-N |
| XLogP | 5.32 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|