C13H9F6N3O2 — CID 19477475
1-methyl-N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19477475) has the molecular formula C13H9F6N3O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 1-methyl-N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19477475 |
| Molecular Formula | C13H9F6N3O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-methyl-N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)cc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9F6N3O2/c1-22-9(6-10(21-22)12(14,15)16)11(23)20-7-2-4-8(5-3-7)24-13(17,18)19/h2-6H,1H3,(H,20,23) |
| InChIKey | JFJKINOQCSELTK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |