C13H12F3N3O2 — CID 19481229
2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 19481229) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19481229 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(OC(F)(F)F)cc2)n(C)n1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-8-7-11(19(2)18-8)12(20)17-9-3-5-10(6-4-9)21-13(14,15)16/h3-7H,1-2H3,(H,17,20) |
| InChIKey | QAFVUTMGYIGWHR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |