C17H12F3N3O4 — CID 135345841
1-methyl-3-[[4-(trifluoromethoxy)phenyl]carbamoyl]indazole-6-carboxylic acid (PubChem CID 135345841) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 1-methyl-3-[[4-(trifluoromethoxy)phenyl]carbamoyl]indazole-6-carboxylic acid.
| Compound Name | 1-methyl-3-[[4-(trifluoromethoxy)phenyl]carbamoyl]indazole-6-carboxylic acid |
|---|---|
| PubChem CID | 135345841 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-methyl-3-[[4-(trifluoromethoxy)phenyl]carbamoyl]indazole-6-carboxylic acid |
| SMILES | Cn1nc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H12F3N3O4/c1-23-13-8-9(16(25)26)2-7-12(13)14(22-23)15(24)21-10-3-5-11(6-4-10)27-17(18,19)20/h2-8H,1H3,(H,21,24)(H,25,26) |
| InChIKey | JZEHZFYNSFOKFN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |