C17H11F4N3O3 — CID 135345831
4-fluoro-6-formyl-1-methyl-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide (PubChem CID 135345831) has the molecular formula C17H11F4N3O3 and a molecular weight of 381.29 g/mol. Its IUPAC name is 4-fluoro-6-formyl-1-methyl-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide.
| Compound Name | 4-fluoro-6-formyl-1-methyl-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 135345831 |
| Molecular Formula | C17H11F4N3O3 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-fluoro-6-formyl-1-methyl-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2c(F)cc(C=O)cc21 |
| InChI | InChI=1S/C17H11F4N3O3/c1-24-13-7-9(8-25)6-12(18)14(13)15(23-24)16(26)22-10-2-4-11(5-3-10)27-17(19,20)21/h2-8H,1H3,(H,22,26) |
| InChIKey | QKZYTEIDGCQXAQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|