C13H11F3N4O4 — CID 90816637
[1-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazol-2-yl] formate (PubChem CID 90816637) has the molecular formula C13H11F3N4O4 and a molecular weight of 344.25 g/mol. Its IUPAC name is [1-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazol-2-yl] formate.
| Compound Name | [1-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazol-2-yl] formate |
|---|---|
| PubChem CID | 90816637 |
| Molecular Formula | C13H11F3N4O4 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [1-methyl-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazol-2-yl] formate |
| SMILES | Cn1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)nc1OC=O |
| InChI | InChI=1S/C13H11F3N4O4/c1-20-6-10(19-12(20)23-7-21)18-11(22)17-8-2-4-9(5-3-8)24-13(14,15)16/h2-7H,1H3,(H2,17,18,22) |
| InChIKey | IRMKJEWZHWSEJU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|