C13H9F6N5O3 — CID 155451100
1-[4-(hydroxyamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 155451100) has the molecular formula C13H9F6N5O3 and a molecular weight of 397.24 g/mol. Its IUPAC name is 1-[4-(hydroxyamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-(hydroxyamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 155451100 |
| Molecular Formula | C13H9F6N5O3 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-[4-(hydroxyamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1nc(NO)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H9F6N5O3/c14-12(15,16)8-5-9(24-26)22-10(21-8)23-11(25)20-6-1-3-7(4-2-6)27-13(17,18)19/h1-5,26H,(H3,20,21,22,23,24,25) |
| InChIKey | WGXHNVBRCIGJHN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|