C20H27F3N6O2 — CID 134297558
1-[4-[3-(dimethylamino)propylamino]-6-propan-2-ylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 134297558) has the molecular formula C20H27F3N6O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-ylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-ylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 134297558 |
| Molecular Formula | C20H27F3N6O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-ylpyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC(C)c1cc(NCCCN(C)C)nc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H27F3N6O2/c1-13(2)16-12-17(24-10-5-11-29(3)4)27-18(26-16)28-19(30)25-14-6-8-15(9-7-14)31-20(21,22)23/h6-9,12-13H,5,10-11H2,1-4H3,(H3,24,25,26,27,28,30) |
| InChIKey | SVLQCMYFWUAVJP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|