C17H21F3N6O2 — CID 134284696
1-[4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 134284696) has the molecular formula C17H21F3N6O2 and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 134284696 |
| Molecular Formula | C17H21F3N6O2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CN(C)CCCNc1ccnc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H21F3N6O2/c1-26(2)11-3-9-21-14-8-10-22-15(24-14)25-16(27)23-12-4-6-13(7-5-12)28-17(18,19)20/h4-8,10H,3,9,11H2,1-2H3,(H3,21,22,23,24,25,27) |
| InChIKey | IZNBAIDHGJTRKG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|