C21H25N5O — CID 112887704
4-N-[3-(dimethylamino)propyl]-2-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112887704) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-2-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-2-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112887704 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-2-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1ccnc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C21H25N5O/c1-26(2)16-6-14-22-20-13-15-23-21(25-20)24-17-9-11-19(12-10-17)27-18-7-4-3-5-8-18/h3-5,7-13,15H,6,14,16H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | WYNNAWDUPHIQRC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|